C16H18Cl2N2O2 — CID 109131098
2-N-[2-(2,4-dichlorophenyl)ethyl]-1-N-prop-2-enylcyclopropane-1,2-dicarboxamide (PubChem CID 109131098) has the molecular formula C16H18Cl2N2O2 and a molecular weight of 341.24 g/mol. Its IUPAC name is 2-N-[2-(2,4-dichlorophenyl)ethyl]-1-N-prop-2-enylcyclopropane-1,2-dicarboxamide.
| Compound Name | 2-N-[2-(2,4-dichlorophenyl)ethyl]-1-N-prop-2-enylcyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 109131098 |
| Molecular Formula | C16H18Cl2N2O2 |
| Molecular Weight | 341.24 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 2-N-[2-(2,4-dichlorophenyl)ethyl]-1-N-prop-2-enylcyclopropane-1,2-dicarboxamide |
| SMILES | C=CCNC(=O)C1CC1C(=O)NCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H18Cl2N2O2/c1-2-6-19-15(21)12-9-13(12)16(22)20-7-5-10-3-4-11(17)8-14(10)18/h2-4,8,12-13H,1,5-7,9H2,(H,19,21)(H,20,22) |
| InChIKey | RYLOSXDVFSIMRF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.24 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|