C15H14ClF3N2O2 — CID 109131188
1-N-[4-chloro-2-(trifluoromethyl)phenyl]-2-N-prop-2-enylcyclopropane-1,2-dicarboxamide (PubChem CID 109131188) has the molecular formula C15H14ClF3N2O2 and a molecular weight of 346.74 g/mol. Its IUPAC name is 1-N-[4-chloro-2-(trifluoromethyl)phenyl]-2-N-prop-2-enylcyclopropane-1,2-dicarboxamide.
| Compound Name | 1-N-[4-chloro-2-(trifluoromethyl)phenyl]-2-N-prop-2-enylcyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 109131188 |
| Molecular Formula | C15H14ClF3N2O2 |
| Molecular Weight | 346.74 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 1-N-[4-chloro-2-(trifluoromethyl)phenyl]-2-N-prop-2-enylcyclopropane-1,2-dicarboxamide |
| SMILES | C=CCNC(=O)C1CC1C(=O)Nc1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C15H14ClF3N2O2/c1-2-5-20-13(22)9-7-10(9)14(23)21-12-4-3-8(16)6-11(12)15(17,18)19/h2-4,6,9-10H,1,5,7H2,(H,20,22)(H,21,23) |
| InChIKey | OQQMEPFHXXCKLY-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.74 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|