C18H34OSi — CID 10913421
(1R,2S,3R)-1-methyl-3-(6-methylhepta-1,5-dien-2-yl)-2-(trimethylsilylmethyl)cyclopentan-1-ol (PubChem CID 10913421) has the molecular formula C18H34OSi and a molecular weight of 294.56 g/mol. Its IUPAC name is (1R,2S,3R)-1-methyl-3-(6-methylhepta-1,5-dien-2-yl)-2-(trimethylsilylmethyl)cyclopentan-1-ol.
| Compound Name | (1R,2S,3R)-1-methyl-3-(6-methylhepta-1,5-dien-2-yl)-2-(trimethylsilylmethyl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 10913421 |
| Molecular Formula | C18H34OSi |
| Molecular Weight | 294.56 g/mol |
| Exact Mass | 294.24 |
| IUPAC Name | (1R,2S,3R)-1-methyl-3-(6-methylhepta-1,5-dien-2-yl)-2-(trimethylsilylmethyl)cyclopentan-1-ol |
| SMILES | C=C(CCC=C(C)C)[C@@H]1CC[C@@](C)(O)[C@H]1C[Si](C)(C)C |
| InChI | InChI=1S/C18H34OSi/c1-14(2)9-8-10-15(3)16-11-12-18(4,19)17(16)13-20(5,6)7/h9,16-17,19H,3,8,10-13H2,1-2,4-7H3/t16-,17-,18+/m0/s1 |
| InChIKey | VXAHAVWKHAZHDM-OKZBNKHCSA-N |
| XLogP | 5.40 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.56 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|