C17H30O3Si — CID 10913936
ethyl (2Z,8E)-10-oxo-2-(trimethylsilylmethyl)undeca-2,8-dienoate (PubChem CID 10913936) has the molecular formula C17H30O3Si and a molecular weight of 310.51 g/mol. Its IUPAC name is ethyl (2Z,8E)-10-oxo-2-(trimethylsilylmethyl)undeca-2,8-dienoate.
| Compound Name | ethyl (2Z,8E)-10-oxo-2-(trimethylsilylmethyl)undeca-2,8-dienoate |
|---|---|
| PubChem CID | 10913936 |
| Molecular Formula | C17H30O3Si |
| Molecular Weight | 310.51 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | ethyl (2Z,8E)-10-oxo-2-(trimethylsilylmethyl)undeca-2,8-dienoate |
| SMILES | CCOC(=O)/C(=C/CCCC/C=C/C(C)=O)C[Si](C)(C)C |
| InChI | InChI=1S/C17H30O3Si/c1-6-20-17(19)16(14-21(3,4)5)13-11-9-7-8-10-12-15(2)18/h10,12-13H,6-9,11,14H2,1-5H3/b12-10+,16-13+ |
| InChIKey | AUTLCAVBXPKHFL-XBKMVRDJSA-N |
| XLogP | 4.52 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.51 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|