C19H26O4 — CID 10914145
(1R,2R,5R,7R,8R,9S,12R,16S)-5-ethenyl-8-hydroxy-1,5-dimethyl-10-oxatetracyclo[7.6.1.02,7.012,16]hexadecane-11,13-dione (PubChem CID 10914145) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is (1R,2R,5R,7R,8R,9S,12R,16S)-5-ethenyl-8-hydroxy-1,5-dimethyl-10-oxatetracyclo[7.6.1.02,7.012,16]hexadecane-11,13-dione.
| Compound Name | (1R,2R,5R,7R,8R,9S,12R,16S)-5-ethenyl-8-hydroxy-1,5-dimethyl-10-oxatetracyclo[7.6.1.02,7.012,16]hexadecane-11,13-dione |
|---|---|
| PubChem CID | 10914145 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | (1R,2R,5R,7R,8R,9S,12R,16S)-5-ethenyl-8-hydroxy-1,5-dimethyl-10-oxatetracyclo[7.6.1.02,7.012,16]hexadecane-11,13-dione |
| SMILES | C=C[C@]1(C)CC[C@@H]2[C@@H](C1)[C@@H](O)[C@H]1OC(=O)[C@H]3C(=O)CC[C@@]2(C)[C@H]31 |
| InChI | InChI=1S/C19H26O4/c1-4-18(2)7-5-11-10(9-18)15(21)16-14-13(17(22)23-16)12(20)6-8-19(11,14)3/h4,10-11,13-16,21H,1,5-9H2,2-3H3/t10-,11-,13+,14-,15-,16+,18-,19-/m1/s1 |
| InChIKey | BJVLLHFMWDYDDQ-MYDLPLDPSA-N |
| XLogP | 2.50 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|