C21H31ClO3 — CID 154132172
(8S,9S,10R,11R,13S,14S,17S)-17-acetyl-4-chloro-11-hydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 154132172) has the molecular formula C21H31ClO3 and a molecular weight of 366.93 g/mol. Its IUPAC name is (8S,9S,10R,11R,13S,14S,17S)-17-acetyl-4-chloro-11-hydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9S,10R,11R,13S,14S,17S)-17-acetyl-4-chloro-11-hydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 154132172 |
| Molecular Formula | C21H31ClO3 |
| Molecular Weight | 366.93 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | (8S,9S,10R,11R,13S,14S,17S)-17-acetyl-4-chloro-11-hydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC(=O)[C@H]1CC[C@H]2[C@@H]3CCC4C(Cl)C(=O)CC[C@]4(C)[C@H]3[C@H](O)C[C@]12C |
| InChI | InChI=1S/C21H31ClO3/c1-11(23)13-6-7-14-12-4-5-15-19(22)16(24)8-9-20(15,2)18(12)17(25)10-21(13,14)3/h12-15,17-19,25H,4-10H2,1-3H3/t12-,13+,14-,15?,17+,18+,19?,20-,21+/m0/s1 |
| InChIKey | GPKOIOQTDPGYJU-YOROGVQXSA-N |
| XLogP | 3.99 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.93 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|