C21H29ClO4 — CID 132514417
(6S,7S,8S,9S,10R,11R,13S,14S,17S)-17-acetyl-7-chloro-6,11-dihydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 132514417) has the molecular formula C21H29ClO4 and a molecular weight of 380.91 g/mol. Its IUPAC name is (6S,7S,8S,9S,10R,11R,13S,14S,17S)-17-acetyl-7-chloro-6,11-dihydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (6S,7S,8S,9S,10R,11R,13S,14S,17S)-17-acetyl-7-chloro-6,11-dihydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 132514417 |
| Molecular Formula | C21H29ClO4 |
| Molecular Weight | 380.91 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | (6S,7S,8S,9S,10R,11R,13S,14S,17S)-17-acetyl-7-chloro-6,11-dihydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC(=O)[C@H]1CC[C@H]2[C@@H]3[C@H](Cl)[C@@H](O)C4=CC(=O)CC[C@]4(C)[C@H]3[C@H](O)C[C@]12C |
| InChI | InChI=1S/C21H29ClO4/c1-10(23)12-4-5-13-16-17(15(25)9-21(12,13)3)20(2)7-6-11(24)8-14(20)19(26)18(16)22/h8,12-13,15-19,25-26H,4-7,9H2,1-3H3/t12-,13+,15-,16+,17+,18+,19+,20+,21-/m1/s1 |
| InChIKey | IKOQMMOZENDARV-NYFAHMBCSA-N |
| XLogP | 2.88 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.91 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|