C20H29N3O2 — CID 109146108
4-N-cyclohexyl-1-N-(pyridin-4-ylmethyl)cyclohexane-1,4-dicarboxamide (PubChem CID 109146108) has the molecular formula C20H29N3O2 and a molecular weight of 343.47 g/mol. Its IUPAC name is 4-N-cyclohexyl-1-N-(pyridin-4-ylmethyl)cyclohexane-1,4-dicarboxamide.
| Compound Name | 4-N-cyclohexyl-1-N-(pyridin-4-ylmethyl)cyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109146108 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | 4-N-cyclohexyl-1-N-(pyridin-4-ylmethyl)cyclohexane-1,4-dicarboxamide |
| SMILES | O=C(NCc1ccncc1)C1CCC(C(=O)NC2CCCCC2)CC1 |
| InChI | InChI=1S/C20H29N3O2/c24-19(22-14-15-10-12-21-13-11-15)16-6-8-17(9-7-16)20(25)23-18-4-2-1-3-5-18/h10-13,16-18H,1-9,14H2,(H,22,24)(H,23,25) |
| InChIKey | JEBBHHCDODNYJL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |