C25H30N4O3 — CID 92604155
(1R,2S,3R)-3-(2-aminobenzoyl)-2-N-cyclohexyl-3-methyl-1-N-(pyridin-4-ylmethyl)cyclopropane-1,2-dicarboxamide (PubChem CID 92604155) has the molecular formula C25H30N4O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is (1R,2S,3R)-3-(2-aminobenzoyl)-2-N-cyclohexyl-3-methyl-1-N-(pyridin-4-ylmethyl)cyclopropane-1,2-dicarboxamide.
| Compound Name | (1R,2S,3R)-3-(2-aminobenzoyl)-2-N-cyclohexyl-3-methyl-1-N-(pyridin-4-ylmethyl)cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 92604155 |
| Molecular Formula | C25H30N4O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | (1R,2S,3R)-3-(2-aminobenzoyl)-2-N-cyclohexyl-3-methyl-1-N-(pyridin-4-ylmethyl)cyclopropane-1,2-dicarboxamide |
| SMILES | C[C@@]1(C(=O)c2ccccc2N)[C@H](C(=O)NCc2ccncc2)[C@@H]1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C25H30N4O3/c1-25(22(30)18-9-5-6-10-19(18)26)20(23(31)28-15-16-11-13-27-14-12-16)21(25)24(32)29-17-7-3-2-4-8-17/h5-6,9-14,17,20-21H,2-4,7-8,15,26H2,1H3,(H,28,31)(H,29,32)/t20-,21+,25+/m0/s1 |
| InChIKey | LHIFJAYPERTLMM-BPYKYCOYSA-N |
| XLogP | 2.86 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|