C21H24N4O3 — CID 47634027
N'-[4-(cyclohexylcarbamoyl)phenyl]-N-(pyridin-4-ylmethyl)oxamide (PubChem CID 47634027) has the molecular formula C21H24N4O3 and a molecular weight of 380.45 g/mol. Its IUPAC name is N'-[4-(cyclohexylcarbamoyl)phenyl]-N-(pyridin-4-ylmethyl)oxamide.
| Compound Name | N'-[4-(cyclohexylcarbamoyl)phenyl]-N-(pyridin-4-ylmethyl)oxamide |
|---|---|
| PubChem CID | 47634027 |
| Molecular Formula | C21H24N4O3 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | N'-[4-(cyclohexylcarbamoyl)phenyl]-N-(pyridin-4-ylmethyl)oxamide |
| SMILES | O=C(NCc1ccncc1)C(=O)Nc1ccc(C(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C21H24N4O3/c26-19(24-17-4-2-1-3-5-17)16-6-8-18(9-7-16)25-21(28)20(27)23-14-15-10-12-22-13-11-15/h6-13,17H,1-5,14H2,(H,23,27)(H,24,26)(H,25,28) |
| InChIKey | VPXURUWZJIYIMW-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|