C21H20N2O3 — CID 10915025
N-(2-hydroxyethyl)-N-(1-oxo-2,3,4,9-tetrahydrocarbazol-4-yl)benzamide (PubChem CID 10915025) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-N-(1-oxo-2,3,4,9-tetrahydrocarbazol-4-yl)benzamide.
| Compound Name | N-(2-hydroxyethyl)-N-(1-oxo-2,3,4,9-tetrahydrocarbazol-4-yl)benzamide |
|---|---|
| PubChem CID | 10915025 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | N-(2-hydroxyethyl)-N-(1-oxo-2,3,4,9-tetrahydrocarbazol-4-yl)benzamide |
| SMILES | O=C1CCC(N(CCO)C(=O)c2ccccc2)c2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C21H20N2O3/c24-13-12-23(21(26)14-6-2-1-3-7-14)17-10-11-18(25)20-19(17)15-8-4-5-9-16(15)22-20/h1-9,17,22,24H,10-13H2 |
| InChIKey | LVJQHZYLXVQQMK-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|