C17H21NO7 — CID 10915124
6-O-benzyl 4-O-methyl (3aR,4R,7aR)-2,2-dimethyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-d]oxazine-4,6-dicarboxylate (PubChem CID 10915124) has the molecular formula C17H21NO7 and a molecular weight of 351.36 g/mol. Its IUPAC name is 6-O-benzyl 4-O-methyl (3aR,4R,7aR)-2,2-dimethyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-d]oxazine-4,6-dicarboxylate.
| Compound Name | 6-O-benzyl 4-O-methyl (3aR,4R,7aR)-2,2-dimethyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-d]oxazine-4,6-dicarboxylate |
|---|---|
| PubChem CID | 10915124 |
| Molecular Formula | C17H21NO7 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 6-O-benzyl 4-O-methyl (3aR,4R,7aR)-2,2-dimethyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-d]oxazine-4,6-dicarboxylate |
| SMILES | COC(=O)[C@@H]1ON(C(=O)OCc2ccccc2)C[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C17H21NO7/c1-17(2)23-12-9-18(25-14(13(12)24-17)15(19)21-3)16(20)22-10-11-7-5-4-6-8-11/h4-8,12-14H,9-10H2,1-3H3/t12-,13-,14-/m1/s1 |
| InChIKey | HUSVATCZZSWAKB-MGPQQGTHSA-N |
| XLogP | 1.63 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |