C19H25N3O4 — CID 109152022
6-(butan-2-ylamino)-N-(3,4,5-trimethoxyphenyl)pyridine-3-carboxamide (PubChem CID 109152022) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is 6-(butan-2-ylamino)-N-(3,4,5-trimethoxyphenyl)pyridine-3-carboxamide.
| Compound Name | 6-(butan-2-ylamino)-N-(3,4,5-trimethoxyphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109152022 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 6-(butan-2-ylamino)-N-(3,4,5-trimethoxyphenyl)pyridine-3-carboxamide |
| SMILES | CCC(C)Nc1ccc(C(=O)Nc2cc(OC)c(OC)c(OC)c2)cn1 |
| InChI | InChI=1S/C19H25N3O4/c1-6-12(2)21-17-8-7-13(11-20-17)19(23)22-14-9-15(24-3)18(26-5)16(10-14)25-4/h7-12H,6H2,1-5H3,(H,20,21)(H,22,23) |
| InChIKey | HEHIJGRORLVYKB-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |