C16H10F5O3P — CID 10915776
[3,3,4,4,4-pentafluorobut-1-ynyl(phenoxy)phosphoryl]oxybenzene (PubChem CID 10915776) has the molecular formula C16H10F5O3P and a molecular weight of 376.22 g/mol. Its IUPAC name is [3,3,4,4,4-pentafluorobut-1-ynyl(phenoxy)phosphoryl]oxybenzene.
| Compound Name | [3,3,4,4,4-pentafluorobut-1-ynyl(phenoxy)phosphoryl]oxybenzene |
|---|---|
| PubChem CID | 10915776 |
| Molecular Formula | C16H10F5O3P |
| Molecular Weight | 376.22 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | [3,3,4,4,4-pentafluorobut-1-ynyl(phenoxy)phosphoryl]oxybenzene |
| SMILES | O=P(C#CC(F)(F)C(F)(F)F)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C16H10F5O3P/c17-15(18,16(19,20)21)11-12-25(22,23-13-7-3-1-4-8-13)24-14-9-5-2-6-10-14/h1-10H |
| InChIKey | CKKNBBOMHMAXDX-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.22 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|