About 2-chloroethoxy-bis(2,3-dimethylphenoxy)-sulfanylidene-lambda5-phosphane
2-chloroethoxy-bis(2,3-dimethylphenoxy)-sulfanylidene-lambda5-phosphane (PubChem CID 10916000) has the molecular formula C18H22ClO3PS
and a molecular weight of 384.87 g/mol. Its IUPAC name is 2-chloroethoxy-bis(2,3-dimethylphenoxy)-sulfanylidene-lambda5-phosphane.
Molecular Properties
| Compound Name | 2-chloroethoxy-bis(2,3-dimethylphenoxy)-sulfanylidene-lambda5-phosphane |
| PubChem CID | 10916000 |
| Molecular Formula | C18H22ClO3PS |
| Molecular Weight | 384.87 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | 2-chloroethoxy-bis(2,3-dimethylphenoxy)-sulfanylidene-lambda5-phosphane |
| SMILES | Cc1cccc(OP(=S)(OCCCl)Oc2cccc(C)c2C)c1C |
| InChI | InChI=1S/C18H22ClO3PS/c1-13-7-5-9-17(15(13)3)21-23(24,20-12-11-19)22-18-10-6-8-14(2)16(18)4/h5-10H,11-12H2,1-4H3 |
| InChIKey | BSDVCYATXMBKNV-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.87 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-chloroethoxy-bis(2,3-dimethylphenoxy)-sulfanylidene-lambda5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloroethoxy-bis(2,3-dimethylphenoxy)-sulfanylidene-lambda5-phosphane?
The IUPAC name of 2-chloroethoxy-bis(2,3-dimethylphenoxy)-sulfanylidene-lambda5-phosphane (CID 10916000) is 2-chloroethoxy-bis(2,3-dimethylphenoxy)-sulfanylidene-lambda5-phosphane.
What is the SMILES notation for 2-chloroethoxy-bis(2,3-dimethylphenoxy)-sulfanylidene-lambda5-phosphane?
The canonical SMILES for 2-chloroethoxy-bis(2,3-dimethylphenoxy)-sulfanylidene-lambda5-phosphane is Cc1cccc(OP(=S)(OCCCl)Oc2cccc(C)c2C)c1C.
What is the InChIKey of 2-chloroethoxy-bis(2,3-dimethylphenoxy)-sulfanylidene-lambda5-phosphane?
The InChIKey is BSDVCYATXMBKNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22ClO3PS/c1-13-7-5-9-17(15(13)3)21-23(24,20-12-11-19)22-18-10-6-8-14(2)16(18)4/h5-10H,11-12H2,1-4H3.
What are the key properties of 2-chloroethoxy-bis(2,3-dimethylphenoxy)-sulfanylidene-lambda5-phosphane?
2-chloroethoxy-bis(2,3-dimethylphenoxy)-sulfanylidene-lambda5-phosphane has a molecular weight of 384.87 g/mol, XLogP of 5.86, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloroethoxy-bis(2,3-dimethylphenoxy)-sulfanylidene-lambda5-phosphane is sourced from PubChem (CID 10916000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).