C17H14F6NO2P — CID 10916578
N-(2-diphenylphosphoryl-1,1,1,3,3,3-hexafluoropropan-2-yl)acetamide (PubChem CID 10916578) has the molecular formula C17H14F6NO2P and a molecular weight of 409.27 g/mol. Its IUPAC name is N-(2-diphenylphosphoryl-1,1,1,3,3,3-hexafluoropropan-2-yl)acetamide.
| Compound Name | N-(2-diphenylphosphoryl-1,1,1,3,3,3-hexafluoropropan-2-yl)acetamide |
|---|---|
| PubChem CID | 10916578 |
| Molecular Formula | C17H14F6NO2P |
| Molecular Weight | 409.27 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | N-(2-diphenylphosphoryl-1,1,1,3,3,3-hexafluoropropan-2-yl)acetamide |
| SMILES | CC(=O)NC(C(F)(F)F)(C(F)(F)F)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H14F6NO2P/c1-12(25)24-15(16(18,19)20,17(21,22)23)27(26,13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-11H,1H3,(H,24,25) |
| InChIKey | NKXHARMCDGLZCX-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.27 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|