C17H11F9NO2P — CID 15001731
N-(2-diphenylphosphoryl-1,1,1,3,3,3-hexafluoropropan-2-yl)-2,2,2-trifluoroacetamide (PubChem CID 15001731) has the molecular formula C17H11F9NO2P and a molecular weight of 463.24 g/mol. Its IUPAC name is N-(2-diphenylphosphoryl-1,1,1,3,3,3-hexafluoropropan-2-yl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(2-diphenylphosphoryl-1,1,1,3,3,3-hexafluoropropan-2-yl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 15001731 |
| Molecular Formula | C17H11F9NO2P |
| Molecular Weight | 463.24 g/mol |
| Exact Mass | 463.04 |
| IUPAC Name | N-(2-diphenylphosphoryl-1,1,1,3,3,3-hexafluoropropan-2-yl)-2,2,2-trifluoroacetamide |
| SMILES | O=C(NC(C(F)(F)F)(C(F)(F)F)P(=O)(c1ccccc1)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C17H11F9NO2P/c18-14(19,20)13(28)27-15(16(21,22)23,17(24,25)26)30(29,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H,(H,27,28) |
| InChIKey | CKAMQOWXKMRJAX-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.24 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|