C15H13F3NO2P — CID 21204835
N-(diphenylphosphorylmethyl)-2,2,2-trifluoroacetamide (PubChem CID 21204835) has the molecular formula C15H13F3NO2P and a molecular weight of 327.24 g/mol. Its IUPAC name is N-(diphenylphosphorylmethyl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(diphenylphosphorylmethyl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 21204835 |
| Molecular Formula | C15H13F3NO2P |
| Molecular Weight | 327.24 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | N-(diphenylphosphorylmethyl)-2,2,2-trifluoroacetamide |
| SMILES | O=C(NCP(=O)(c1ccccc1)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C15H13F3NO2P/c16-15(17,18)14(20)19-11-22(21,12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10H,11H2,(H,19,20) |
| InChIKey | JZLFHIJQEVWREV-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.24 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|