C16H12Cl3F3NO2P — CID 2303503
2,2,2-trifluoro-N-[(1R)-2,2,2-trichloro-1-diphenylphosphorylethyl]acetamide (PubChem CID 2303503) has the molecular formula C16H12Cl3F3NO2P and a molecular weight of 444.60 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(1R)-2,2,2-trichloro-1-diphenylphosphorylethyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(1R)-2,2,2-trichloro-1-diphenylphosphorylethyl]acetamide |
|---|---|
| PubChem CID | 2303503 |
| Molecular Formula | C16H12Cl3F3NO2P |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 442.96 |
| IUPAC Name | 2,2,2-trifluoro-N-[(1R)-2,2,2-trichloro-1-diphenylphosphorylethyl]acetamide |
| SMILES | O=C(N[C@@H](C(Cl)(Cl)Cl)P(=O)(c1ccccc1)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C16H12Cl3F3NO2P/c17-15(18,19)14(23-13(24)16(20,21)22)26(25,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,14H,(H,23,24)/t14-/m1/s1 |
| InChIKey | BRCPSPCFRNXHSB-CQSZACIVSA-N |
| XLogP | 4.38 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|