C22H28N4O — CID 109166673
2-[2-(cyclohexen-1-yl)ethylamino]-N-methyl-N-(2-pyridin-4-ylethyl)pyridine-4-carboxamide (PubChem CID 109166673) has the molecular formula C22H28N4O and a molecular weight of 364.49 g/mol. Its IUPAC name is 2-[2-(cyclohexen-1-yl)ethylamino]-N-methyl-N-(2-pyridin-4-ylethyl)pyridine-4-carboxamide.
| Compound Name | 2-[2-(cyclohexen-1-yl)ethylamino]-N-methyl-N-(2-pyridin-4-ylethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 109166673 |
| Molecular Formula | C22H28N4O |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | 2-[2-(cyclohexen-1-yl)ethylamino]-N-methyl-N-(2-pyridin-4-ylethyl)pyridine-4-carboxamide |
| SMILES | CN(CCc1ccncc1)C(=O)c1ccnc(NCCC2=CCCCC2)c1 |
| InChI | InChI=1S/C22H28N4O/c1-26(16-11-19-7-12-23-13-8-19)22(27)20-10-15-25-21(17-20)24-14-9-18-5-3-2-4-6-18/h5,7-8,10,12-13,15,17H,2-4,6,9,11,14,16H2,1H3,(H,24,25) |
| InChIKey | RPKFKZLWVOYINQ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|