C15H20N4O4S — CID 109168928
N-(1,1-dioxothiolan-3-yl)-2-(4-formylpiperazin-1-yl)pyridine-4-carboxamide (PubChem CID 109168928) has the molecular formula C15H20N4O4S and a molecular weight of 352.42 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-(4-formylpiperazin-1-yl)pyridine-4-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-(4-formylpiperazin-1-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 109168928 |
| Molecular Formula | C15H20N4O4S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-(4-formylpiperazin-1-yl)pyridine-4-carboxamide |
| SMILES | O=CN1CCN(c2cc(C(=O)NC3CCS(=O)(=O)C3)ccn2)CC1 |
| InChI | InChI=1S/C15H20N4O4S/c20-11-18-4-6-19(7-5-18)14-9-12(1-3-16-14)15(21)17-13-2-8-24(22,23)10-13/h1,3,9,11,13H,2,4-8,10H2,(H,17,21) |
| InChIKey | WPDHVPAMWNZKND-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|