C25H30N2O6 — CID 10917429
(Z)-2-[[3-methoxy-4-[(3,4,5-trimethoxyphenyl)methoxy]phenyl]methyl]-3-morpholin-4-ylprop-2-enenitrile (PubChem CID 10917429) has the molecular formula C25H30N2O6 and a molecular weight of 454.52 g/mol. Its IUPAC name is (Z)-2-[[3-methoxy-4-[(3,4,5-trimethoxyphenyl)methoxy]phenyl]methyl]-3-morpholin-4-ylprop-2-enenitrile.
| Compound Name | (Z)-2-[[3-methoxy-4-[(3,4,5-trimethoxyphenyl)methoxy]phenyl]methyl]-3-morpholin-4-ylprop-2-enenitrile |
|---|---|
| PubChem CID | 10917429 |
| Molecular Formula | C25H30N2O6 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | (Z)-2-[[3-methoxy-4-[(3,4,5-trimethoxyphenyl)methoxy]phenyl]methyl]-3-morpholin-4-ylprop-2-enenitrile |
| SMILES | COc1cc(C/C(C#N)=C/N2CCOCC2)ccc1OCc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C25H30N2O6/c1-28-22-12-18(11-20(15-26)16-27-7-9-32-10-8-27)5-6-21(22)33-17-19-13-23(29-2)25(31-4)24(14-19)30-3/h5-6,12-14,16H,7-11,17H2,1-4H3/b20-16- |
| InChIKey | JNSMLCVVZGCCKR-SILNSSARSA-N |
| XLogP | 3.58 |
| TPSA | 82.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|