C23H43NO7Si — CID 10917728
tert-butyl (4S)-4-[(4S,5R)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-2-oxoethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 10917728) has the molecular formula C23H43NO7Si and a molecular weight of 473.68 g/mol. Its IUPAC name is tert-butyl (4S)-4-[(4S,5R)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-2-oxoethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S)-4-[(4S,5R)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-2-oxoethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 10917728 |
| Molecular Formula | C23H43NO7Si |
| Molecular Weight | 473.68 g/mol |
| Exact Mass | 473.28 |
| IUPAC Name | tert-butyl (4S)-4-[(4S,5R)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-2-oxoethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H]([C@@H]2OC(C)(C)O[C@H]2[C@@H](C=O)O[Si](C)(C)C(C)(C)C)COC1(C)C |
| InChI | InChI=1S/C23H43NO7Si/c1-20(2,3)30-19(26)24-15(14-27-22(24,7)8)17-18(29-23(9,10)28-17)16(13-25)31-32(11,12)21(4,5)6/h13,15-18H,14H2,1-12H3/t15-,16+,17-,18-/m0/s1 |
| InChIKey | ILPAYTVEZDPPDV-MHORFTMASA-N |
| XLogP | 4.47 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.68 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|