C18H35NO5Si — CID 171613504
tert-butyl 3-[1-[tert-butyl(dimethyl)silyl]oxy-2-oxoethyl]-1,4-oxazepane-4-carboxylate (PubChem CID 171613504) has the molecular formula C18H35NO5Si and a molecular weight of 373.57 g/mol. Its IUPAC name is tert-butyl 3-[1-[tert-butyl(dimethyl)silyl]oxy-2-oxoethyl]-1,4-oxazepane-4-carboxylate.
| Compound Name | tert-butyl 3-[1-[tert-butyl(dimethyl)silyl]oxy-2-oxoethyl]-1,4-oxazepane-4-carboxylate |
|---|---|
| PubChem CID | 171613504 |
| Molecular Formula | C18H35NO5Si |
| Molecular Weight | 373.57 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | tert-butyl 3-[1-[tert-butyl(dimethyl)silyl]oxy-2-oxoethyl]-1,4-oxazepane-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCOCC1C(C=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H35NO5Si/c1-17(2,3)23-16(21)19-10-9-11-22-13-14(19)15(12-20)24-25(7,8)18(4,5)6/h12,14-15H,9-11,13H2,1-8H3 |
| InChIKey | ZAGKLDCOLQOWFB-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.57 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|