C18H33NO4 — CID 103554180
tert-butyl 3-[(2-ethylcyclohexyl)-hydroxymethyl]morpholine-4-carboxylate (PubChem CID 103554180) has the molecular formula C18H33NO4 and a molecular weight of 327.47 g/mol. Its IUPAC name is tert-butyl 3-[(2-ethylcyclohexyl)-hydroxymethyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl 3-[(2-ethylcyclohexyl)-hydroxymethyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 103554180 |
| Molecular Formula | C18H33NO4 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.24 |
| IUPAC Name | tert-butyl 3-[(2-ethylcyclohexyl)-hydroxymethyl]morpholine-4-carboxylate |
| SMILES | CCC1CCCCC1C(O)C1COCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H33NO4/c1-5-13-8-6-7-9-14(13)16(20)15-12-22-11-10-19(15)17(21)23-18(2,3)4/h13-16,20H,5-12H2,1-4H3 |
| InChIKey | PVJQXBYEJXYURN-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |