C14H24N4O4 — CID 107048261
tert-butyl 3-[1-hydroxy-2-(1-methyltriazol-4-yl)ethyl]morpholine-4-carboxylate (PubChem CID 107048261) has the molecular formula C14H24N4O4 and a molecular weight of 312.37 g/mol. Its IUPAC name is tert-butyl 3-[1-hydroxy-2-(1-methyltriazol-4-yl)ethyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl 3-[1-hydroxy-2-(1-methyltriazol-4-yl)ethyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 107048261 |
| Molecular Formula | C14H24N4O4 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | tert-butyl 3-[1-hydroxy-2-(1-methyltriazol-4-yl)ethyl]morpholine-4-carboxylate |
| SMILES | Cn1cc(CC(O)C2COCCN2C(=O)OC(C)(C)C)nn1 |
| InChI | InChI=1S/C14H24N4O4/c1-14(2,3)22-13(20)18-5-6-21-9-11(18)12(19)7-10-8-17(4)16-15-10/h8,11-12,19H,5-7,9H2,1-4H3 |
| InChIKey | ITMICIGNYKHPEQ-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |