C15H25NO6 — CID 178201481
tert-butyl 3-(1-ethoxy-1,3-dioxobutan-2-yl)morpholine-4-carboxylate (PubChem CID 178201481) has the molecular formula C15H25NO6 and a molecular weight of 315.37 g/mol. Its IUPAC name is tert-butyl 3-(1-ethoxy-1,3-dioxobutan-2-yl)morpholine-4-carboxylate.
| Compound Name | tert-butyl 3-(1-ethoxy-1,3-dioxobutan-2-yl)morpholine-4-carboxylate |
|---|---|
| PubChem CID | 178201481 |
| Molecular Formula | C15H25NO6 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | tert-butyl 3-(1-ethoxy-1,3-dioxobutan-2-yl)morpholine-4-carboxylate |
| SMILES | CCOC(=O)C(C(C)=O)C1COCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H25NO6/c1-6-21-13(18)12(10(2)17)11-9-20-8-7-16(11)14(19)22-15(3,4)5/h11-12H,6-9H2,1-5H3 |
| InChIKey | LDBGCADWWXIONK-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|