C17H34N2O4 — CID 138049565
tert-butyl 3-[1-[(2-hydroxy-2-methylpentyl)amino]ethyl]morpholine-4-carboxylate (PubChem CID 138049565) has the molecular formula C17H34N2O4 and a molecular weight of 330.47 g/mol. Its IUPAC name is tert-butyl 3-[1-[(2-hydroxy-2-methylpentyl)amino]ethyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl 3-[1-[(2-hydroxy-2-methylpentyl)amino]ethyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 138049565 |
| Molecular Formula | C17H34N2O4 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.25 |
| IUPAC Name | tert-butyl 3-[1-[(2-hydroxy-2-methylpentyl)amino]ethyl]morpholine-4-carboxylate |
| SMILES | CCCC(C)(O)CNC(C)C1COCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H34N2O4/c1-7-8-17(6,21)12-18-13(2)14-11-22-10-9-19(14)15(20)23-16(3,4)5/h13-14,18,21H,7-12H2,1-6H3 |
| InChIKey | CLTLKMKVOAPLGO-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |