C13H23NO4S — CID 176612549
tert-butyl (3S)-3-(acetylsulfanylmethyl)-1,4-oxazepane-4-carboxylate (PubChem CID 176612549) has the molecular formula C13H23NO4S and a molecular weight of 289.40 g/mol. Its IUPAC name is tert-butyl (3S)-3-(acetylsulfanylmethyl)-1,4-oxazepane-4-carboxylate.
| Compound Name | tert-butyl (3S)-3-(acetylsulfanylmethyl)-1,4-oxazepane-4-carboxylate |
|---|---|
| PubChem CID | 176612549 |
| Molecular Formula | C13H23NO4S |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | tert-butyl (3S)-3-(acetylsulfanylmethyl)-1,4-oxazepane-4-carboxylate |
| SMILES | CC(=O)SC[C@@H]1COCCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H23NO4S/c1-10(15)19-9-11-8-17-7-5-6-14(11)12(16)18-13(2,3)4/h11H,5-9H2,1-4H3/t11-/m0/s1 |
| InChIKey | XOOYNUCMQUUYJI-NSHDSACASA-N |
| XLogP | 2.29 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|