C15H13Cl2N3O — CID 109180409
5-(3,5-dichloroanilino)-N-prop-2-enylpyridine-2-carboxamide (PubChem CID 109180409) has the molecular formula C15H13Cl2N3O and a molecular weight of 322.20 g/mol. Its IUPAC name is 5-(3,5-dichloroanilino)-N-prop-2-enylpyridine-2-carboxamide.
| Compound Name | 5-(3,5-dichloroanilino)-N-prop-2-enylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 109180409 |
| Molecular Formula | C15H13Cl2N3O |
| Molecular Weight | 322.20 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | 5-(3,5-dichloroanilino)-N-prop-2-enylpyridine-2-carboxamide |
| SMILES | C=CCNC(=O)c1ccc(Nc2cc(Cl)cc(Cl)c2)cn1 |
| InChI | InChI=1S/C15H13Cl2N3O/c1-2-5-18-15(21)14-4-3-12(9-19-14)20-13-7-10(16)6-11(17)8-13/h2-4,6-9,20H,1,5H2,(H,18,21) |
| InChIKey | JVDCOMUGLYLBTK-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.20 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|