C19H21ClN4O — CID 109180488
[4-(3-chlorophenyl)piperazin-1-yl]-[5-(prop-2-enylamino)-2-pyridinyl]methanone (PubChem CID 109180488) has the molecular formula C19H21ClN4O and a molecular weight of 356.86 g/mol. Its IUPAC name is [4-(3-chlorophenyl)piperazin-1-yl]-[5-(prop-2-enylamino)-2-pyridinyl]methanone.
| Compound Name | [4-(3-chlorophenyl)piperazin-1-yl]-[5-(prop-2-enylamino)-2-pyridinyl]methanone |
|---|---|
| PubChem CID | 109180488 |
| Molecular Formula | C19H21ClN4O |
| Molecular Weight | 356.86 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | [4-(3-chlorophenyl)piperazin-1-yl]-[5-(prop-2-enylamino)-2-pyridinyl]methanone |
| SMILES | C=CCNc1ccc(C(=O)N2CCN(c3cccc(Cl)c3)CC2)nc1 |
| InChI | InChI=1S/C19H21ClN4O/c1-2-8-21-16-6-7-18(22-14-16)19(25)24-11-9-23(10-12-24)17-5-3-4-15(20)13-17/h2-7,13-14,21H,1,8-12H2 |
| InChIKey | LLXCMBLBVOKVAL-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.86 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|