C31H38O4Si — CID 10918143
(5S)-5-[(1R,2R)-3-[tert-butyl(diphenyl)silyl]oxy-2-methyl-1-phenylmethoxypropyl]oxolan-2-one (PubChem CID 10918143) has the molecular formula C31H38O4Si and a molecular weight of 502.73 g/mol. Its IUPAC name is (5S)-5-[(1R,2R)-3-[tert-butyl(diphenyl)silyl]oxy-2-methyl-1-phenylmethoxypropyl]oxolan-2-one.
| Compound Name | (5S)-5-[(1R,2R)-3-[tert-butyl(diphenyl)silyl]oxy-2-methyl-1-phenylmethoxypropyl]oxolan-2-one |
|---|---|
| PubChem CID | 10918143 |
| Molecular Formula | C31H38O4Si |
| Molecular Weight | 502.73 g/mol |
| Exact Mass | 502.25 |
| IUPAC Name | (5S)-5-[(1R,2R)-3-[tert-butyl(diphenyl)silyl]oxy-2-methyl-1-phenylmethoxypropyl]oxolan-2-one |
| SMILES | C[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H](OCc1ccccc1)[C@@H]1CCC(=O)O1 |
| InChI | InChI=1S/C31H38O4Si/c1-24(30(28-20-21-29(32)35-28)33-23-25-14-8-5-9-15-25)22-34-36(31(2,3)4,26-16-10-6-11-17-26)27-18-12-7-13-19-27/h5-19,24,28,30H,20-23H2,1-4H3/t24-,28+,30-/m1/s1 |
| InChIKey | BGOSPIVHFULJQP-SHFQUTHWSA-N |
| XLogP | 5.49 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.73 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|