C21H30O13S — CID 10918383
[(3R,4S,5R,6S)-4,5-diacetyloxy-6-[(3R,4S,5R,6S)-4,5-diacetyloxy-6-methylsulfanyloxan-3-yl]oxyoxan-3-yl] acetate (PubChem CID 10918383) has the molecular formula C21H30O13S and a molecular weight of 522.53 g/mol. Its IUPAC name is [(3R,4S,5R,6S)-4,5-diacetyloxy-6-[(3R,4S,5R,6S)-4,5-diacetyloxy-6-methylsulfanyloxan-3-yl]oxyoxan-3-yl] acetate.
| Compound Name | [(3R,4S,5R,6S)-4,5-diacetyloxy-6-[(3R,4S,5R,6S)-4,5-diacetyloxy-6-methylsulfanyloxan-3-yl]oxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 10918383 |
| Molecular Formula | C21H30O13S |
| Molecular Weight | 522.53 g/mol |
| Exact Mass | 522.14 |
| IUPAC Name | [(3R,4S,5R,6S)-4,5-diacetyloxy-6-[(3R,4S,5R,6S)-4,5-diacetyloxy-6-methylsulfanyloxan-3-yl]oxyoxan-3-yl] acetate |
| SMILES | CS[C@@H]1OC[C@@H](O[C@@H]2OC[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C21H30O13S/c1-9(22)29-14-7-27-20(18(32-12(4)25)16(14)30-10(2)23)34-15-8-28-21(35-6)19(33-13(5)26)17(15)31-11(3)24/h14-21H,7-8H2,1-6H3/t14-,15-,16+,17+,18-,19-,20+,21+/m1/s1 |
| InChIKey | NRGSIOBZLMMJBP-VJKOAXELSA-N |
| XLogP | 0.11 |
| TPSA | 159.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.53 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|