C17H19N3O — CID 109202307
N-(2-phenylethyl)-4-(prop-2-enylamino)pyridine-2-carboxamide (PubChem CID 109202307) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is N-(2-phenylethyl)-4-(prop-2-enylamino)pyridine-2-carboxamide.
| Compound Name | N-(2-phenylethyl)-4-(prop-2-enylamino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109202307 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | N-(2-phenylethyl)-4-(prop-2-enylamino)pyridine-2-carboxamide |
| SMILES | C=CCNc1ccnc(C(=O)NCCc2ccccc2)c1 |
| InChI | InChI=1S/C17H19N3O/c1-2-10-18-15-9-12-19-16(13-15)17(21)20-11-8-14-6-4-3-5-7-14/h2-7,9,12-13H,1,8,10-11H2,(H,18,19)(H,20,21) |
| InChIKey | YBGWHSVMIFGFBF-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|