C19H20F3N3O — CID 109205195
(4-methylpiperidin-1-yl)-[4-[3-(trifluoromethyl)anilino]-2-pyridinyl]methanone (PubChem CID 109205195) has the molecular formula C19H20F3N3O and a molecular weight of 363.38 g/mol. Its IUPAC name is (4-methylpiperidin-1-yl)-[4-[3-(trifluoromethyl)anilino]-2-pyridinyl]methanone.
| Compound Name | (4-methylpiperidin-1-yl)-[4-[3-(trifluoromethyl)anilino]-2-pyridinyl]methanone |
|---|---|
| PubChem CID | 109205195 |
| Molecular Formula | C19H20F3N3O |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | (4-methylpiperidin-1-yl)-[4-[3-(trifluoromethyl)anilino]-2-pyridinyl]methanone |
| SMILES | CC1CCN(C(=O)c2cc(Nc3cccc(C(F)(F)F)c3)ccn2)CC1 |
| InChI | InChI=1S/C19H20F3N3O/c1-13-6-9-25(10-7-13)18(26)17-12-16(5-8-23-17)24-15-4-2-3-14(11-15)19(20,21)22/h2-5,8,11-13H,6-7,9-10H2,1H3,(H,23,24) |
| InChIKey | SHOLNKVAZXCLJS-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |