C19H19F3N4O2 — CID 109209109
1-[4-[4-[4-(trifluoromethyl)anilino]pyridine-2-carbonyl]piperazin-1-yl]ethanone (PubChem CID 109209109) has the molecular formula C19H19F3N4O2 and a molecular weight of 392.38 g/mol. Its IUPAC name is 1-[4-[4-[4-(trifluoromethyl)anilino]pyridine-2-carbonyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[4-[4-(trifluoromethyl)anilino]pyridine-2-carbonyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 109209109 |
| Molecular Formula | C19H19F3N4O2 |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 1-[4-[4-[4-(trifluoromethyl)anilino]pyridine-2-carbonyl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(C(=O)c2cc(Nc3ccc(C(F)(F)F)cc3)ccn2)CC1 |
| InChI | InChI=1S/C19H19F3N4O2/c1-13(27)25-8-10-26(11-9-25)18(28)17-12-16(6-7-23-17)24-15-4-2-14(3-5-15)19(20,21)22/h2-7,12H,8-11H2,1H3,(H,23,24) |
| InChIKey | DUNJMLVYPJUGAC-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |