C17H19ClN4O — CID 109208151
[4-(3-chloroanilino)-2-pyridinyl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 109208151) has the molecular formula C17H19ClN4O and a molecular weight of 330.82 g/mol. Its IUPAC name is [4-(3-chloroanilino)-2-pyridinyl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [4-(3-chloroanilino)-2-pyridinyl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 109208151 |
| Molecular Formula | C17H19ClN4O |
| Molecular Weight | 330.82 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | [4-(3-chloroanilino)-2-pyridinyl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | CN1CCN(C(=O)c2cc(Nc3cccc(Cl)c3)ccn2)CC1 |
| InChI | InChI=1S/C17H19ClN4O/c1-21-7-9-22(10-8-21)17(23)16-12-15(5-6-19-16)20-14-4-2-3-13(18)11-14/h2-6,11-12H,7-10H2,1H3,(H,19,20) |
| InChIKey | BCNIEUVGXHOHIF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.82 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |