C17H19Cl2N3O — CID 109217686
N-(3,5-dichlorophenyl)-4-(pentylamino)pyridine-2-carboxamide (PubChem CID 109217686) has the molecular formula C17H19Cl2N3O and a molecular weight of 352.27 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-4-(pentylamino)pyridine-2-carboxamide.
| Compound Name | N-(3,5-dichlorophenyl)-4-(pentylamino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109217686 |
| Molecular Formula | C17H19Cl2N3O |
| Molecular Weight | 352.27 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | N-(3,5-dichlorophenyl)-4-(pentylamino)pyridine-2-carboxamide |
| SMILES | CCCCCNc1ccnc(C(=O)Nc2cc(Cl)cc(Cl)c2)c1 |
| InChI | InChI=1S/C17H19Cl2N3O/c1-2-3-4-6-20-14-5-7-21-16(11-14)17(23)22-15-9-12(18)8-13(19)10-15/h5,7-11H,2-4,6H2,1H3,(H,20,21)(H,22,23) |
| InChIKey | XARQXJGUAPGEKT-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.27 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|