C19H23N3O3 — CID 109226008
N-cyclopentyl-5-(2,5-dimethoxyanilino)pyridine-3-carboxamide (PubChem CID 109226008) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is N-cyclopentyl-5-(2,5-dimethoxyanilino)pyridine-3-carboxamide.
| Compound Name | N-cyclopentyl-5-(2,5-dimethoxyanilino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109226008 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | N-cyclopentyl-5-(2,5-dimethoxyanilino)pyridine-3-carboxamide |
| SMILES | COc1ccc(OC)c(Nc2cncc(C(=O)NC3CCCC3)c2)c1 |
| InChI | InChI=1S/C19H23N3O3/c1-24-16-7-8-18(25-2)17(10-16)21-15-9-13(11-20-12-15)19(23)22-14-5-3-4-6-14/h7-12,14,21H,3-6H2,1-2H3,(H,22,23) |
| InChIKey | KZJPXWVAKDCGAR-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |