C13H22O2Si — CID 10922614
(5-methoxy-6-prop-2-enylcyclohexa-1,5-dien-1-yl)oxy-trimethylsilane (PubChem CID 10922614) has the molecular formula C13H22O2Si and a molecular weight of 238.40 g/mol. Its IUPAC name is (5-methoxy-6-prop-2-enylcyclohexa-1,5-dien-1-yl)oxy-trimethylsilane.
| Compound Name | (5-methoxy-6-prop-2-enylcyclohexa-1,5-dien-1-yl)oxy-trimethylsilane |
|---|---|
| PubChem CID | 10922614 |
| Molecular Formula | C13H22O2Si |
| Molecular Weight | 238.40 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | (5-methoxy-6-prop-2-enylcyclohexa-1,5-dien-1-yl)oxy-trimethylsilane |
| SMILES | C=CCC1=C(OC)CCC=C1O[Si](C)(C)C |
| InChI | InChI=1S/C13H22O2Si/c1-6-8-11-12(14-2)9-7-10-13(11)15-16(3,4)5/h6,10H,1,7-9H2,2-5H3 |
| InChIKey | FTXVSXVFARKIAO-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.40 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|