C20H25N3O4 — CID 109226421
piperidin-1-yl-[5-(3,4,5-trimethoxyanilino)-3-pyridinyl]methanone (PubChem CID 109226421) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is piperidin-1-yl-[5-(3,4,5-trimethoxyanilino)-3-pyridinyl]methanone.
| Compound Name | piperidin-1-yl-[5-(3,4,5-trimethoxyanilino)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 109226421 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | piperidin-1-yl-[5-(3,4,5-trimethoxyanilino)-3-pyridinyl]methanone |
| SMILES | COc1cc(Nc2cncc(C(=O)N3CCCCC3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C20H25N3O4/c1-25-17-10-15(11-18(26-2)19(17)27-3)22-16-9-14(12-21-13-16)20(24)23-7-5-4-6-8-23/h9-13,22H,4-8H2,1-3H3 |
| InChIKey | XQDLNMPFWUKUBV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |