C12H16O4S — CID 10923148
(4R,5R)-2-(benzenesulfonylmethyl)-4,5-dimethyl-1,3-dioxolane (PubChem CID 10923148) has the molecular formula C12H16O4S and a molecular weight of 256.32 g/mol. Its IUPAC name is (4R,5R)-2-(benzenesulfonylmethyl)-4,5-dimethyl-1,3-dioxolane.
| Compound Name | (4R,5R)-2-(benzenesulfonylmethyl)-4,5-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 10923148 |
| Molecular Formula | C12H16O4S |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | (4R,5R)-2-(benzenesulfonylmethyl)-4,5-dimethyl-1,3-dioxolane |
| SMILES | C[C@H]1OC(CS(=O)(=O)c2ccccc2)O[C@@H]1C |
| InChI | InChI=1S/C12H16O4S/c1-9-10(2)16-12(15-9)8-17(13,14)11-6-4-3-5-7-11/h3-7,9-10,12H,8H2,1-2H3/t9-,10-/m1/s1 |
| InChIKey | ZYSNXTKSBHWTCC-NXEZZACHSA-N |
| XLogP | 1.61 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |