C20H32O — CID 10924207
1-[(3R,3aR,6aR,7S,9aR,9bS)-5,9a-dimethyl-7-propan-2-yl-1,2,3,3a,4,6a,7,8,9,9b-decahydrocyclopenta[e]azulen-3-yl]ethanone (PubChem CID 10924207) has the molecular formula C20H32O and a molecular weight of 288.48 g/mol. Its IUPAC name is 1-[(3R,3aR,6aR,7S,9aR,9bS)-5,9a-dimethyl-7-propan-2-yl-1,2,3,3a,4,6a,7,8,9,9b-decahydrocyclopenta[e]azulen-3-yl]ethanone.
| Compound Name | 1-[(3R,3aR,6aR,7S,9aR,9bS)-5,9a-dimethyl-7-propan-2-yl-1,2,3,3a,4,6a,7,8,9,9b-decahydrocyclopenta[e]azulen-3-yl]ethanone |
|---|---|
| PubChem CID | 10924207 |
| Molecular Formula | C20H32O |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.25 |
| IUPAC Name | 1-[(3R,3aR,6aR,7S,9aR,9bS)-5,9a-dimethyl-7-propan-2-yl-1,2,3,3a,4,6a,7,8,9,9b-decahydrocyclopenta[e]azulen-3-yl]ethanone |
| SMILES | CC(=O)[C@@H]1CC[C@H]2[C@H]1CC(C)=C[C@H]1[C@H](C(C)C)CC[C@@]12C |
| InChI | InChI=1S/C20H32O/c1-12(2)15-8-9-20(5)18-7-6-16(14(4)21)17(18)10-13(3)11-19(15)20/h11-12,15-19H,6-10H2,1-5H3/t15-,16-,17-,18-,19-,20+/m0/s1 |
| InChIKey | OAAVQRCGIFIQFT-RPZLJYRGSA-N |
| XLogP | 5.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|