C20H30O — CID 155545803
(1Z,3R,6S,7R,9Z)-3,10,14-trimethyl-6-propan-2-yltricyclo[9.3.0.03,7]tetradeca-1,9-dien-4-one (PubChem CID 155545803) has the molecular formula C20H30O and a molecular weight of 286.46 g/mol. Its IUPAC name is (1Z,3R,6S,7R,9Z)-3,10,14-trimethyl-6-propan-2-yltricyclo[9.3.0.03,7]tetradeca-1,9-dien-4-one.
| Compound Name | (1Z,3R,6S,7R,9Z)-3,10,14-trimethyl-6-propan-2-yltricyclo[9.3.0.03,7]tetradeca-1,9-dien-4-one |
|---|---|
| PubChem CID | 155545803 |
| Molecular Formula | C20H30O |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | (1Z,3R,6S,7R,9Z)-3,10,14-trimethyl-6-propan-2-yltricyclo[9.3.0.03,7]tetradeca-1,9-dien-4-one |
| SMILES | C/C1=C/C[C@@H]2[C@H](C(C)C)CC(=O)[C@@]2(C)/C=C2/C(C)CCC12 |
| InChI | InChI=1S/C20H30O/c1-12(2)16-10-19(21)20(5)11-17-14(4)6-8-15(17)13(3)7-9-18(16)20/h7,11-12,14-16,18H,6,8-10H2,1-5H3/b13-7-,17-11-/t14?,15?,16-,18+,20-/m0/s1 |
| InChIKey | RGKCEUJAXSZNIA-HBGGRVCGSA-N |
| XLogP | 5.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|