C17H23N5O3S — CID 109248675
2-(2-methylpropylamino)-N-[2-(4-sulfamoylphenyl)ethyl]pyrimidine-5-carboxamide (PubChem CID 109248675) has the molecular formula C17H23N5O3S and a molecular weight of 377.47 g/mol. Its IUPAC name is 2-(2-methylpropylamino)-N-[2-(4-sulfamoylphenyl)ethyl]pyrimidine-5-carboxamide.
| Compound Name | 2-(2-methylpropylamino)-N-[2-(4-sulfamoylphenyl)ethyl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109248675 |
| Molecular Formula | C17H23N5O3S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 2-(2-methylpropylamino)-N-[2-(4-sulfamoylphenyl)ethyl]pyrimidine-5-carboxamide |
| SMILES | CC(C)CNc1ncc(C(=O)NCCc2ccc(S(N)(=O)=O)cc2)cn1 |
| InChI | InChI=1S/C17H23N5O3S/c1-12(2)9-20-17-21-10-14(11-22-17)16(23)19-8-7-13-3-5-15(6-4-13)26(18,24)25/h3-6,10-12H,7-9H2,1-2H3,(H,19,23)(H2,18,24,25)(H,20,21,22) |
| InChIKey | WUFMEVKUCGTELC-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 127.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |