C18H21NO7 — CID 1092508
methyl 4-[(2S)-3-acetyl-1-(2,2-dimethoxyethyl)-4-hydroxy-5-oxo-2H-pyrrol-2-yl]benzoate (PubChem CID 1092508) has the molecular formula C18H21NO7 and a molecular weight of 363.37 g/mol. Its IUPAC name is methyl 4-[(2S)-3-acetyl-1-(2,2-dimethoxyethyl)-4-hydroxy-5-oxo-2H-pyrrol-2-yl]benzoate.
| Compound Name | methyl 4-[(2S)-3-acetyl-1-(2,2-dimethoxyethyl)-4-hydroxy-5-oxo-2H-pyrrol-2-yl]benzoate |
|---|---|
| PubChem CID | 1092508 |
| Molecular Formula | C18H21NO7 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | methyl 4-[(2S)-3-acetyl-1-(2,2-dimethoxyethyl)-4-hydroxy-5-oxo-2H-pyrrol-2-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@H]2C(C(C)=O)=C(O)C(=O)N2CC(OC)OC)cc1 |
| InChI | InChI=1S/C18H21NO7/c1-10(20)14-15(11-5-7-12(8-6-11)18(23)26-4)19(17(22)16(14)21)9-13(24-2)25-3/h5-8,13,15,21H,9H2,1-4H3/t15-/m0/s1 |
| InChIKey | TWYDDEJTDVIUMF-HNNXBMFYSA-N |
| XLogP | 1.38 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|