C21H26N2O5 — CID 75792675
methyl 4-[3-acetyl-4-hydroxy-5-oxo-1-(2-piperidin-1-ylethyl)-2H-pyrrol-2-yl]benzoate (PubChem CID 75792675) has the molecular formula C21H26N2O5 and a molecular weight of 386.45 g/mol. Its IUPAC name is methyl 4-[3-acetyl-4-hydroxy-5-oxo-1-(2-piperidin-1-ylethyl)-2H-pyrrol-2-yl]benzoate.
| Compound Name | methyl 4-[3-acetyl-4-hydroxy-5-oxo-1-(2-piperidin-1-ylethyl)-2H-pyrrol-2-yl]benzoate |
|---|---|
| PubChem CID | 75792675 |
| Molecular Formula | C21H26N2O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | methyl 4-[3-acetyl-4-hydroxy-5-oxo-1-(2-piperidin-1-ylethyl)-2H-pyrrol-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2C(C(C)=O)=C(O)C(=O)N2CCN2CCCCC2)cc1 |
| InChI | InChI=1S/C21H26N2O5/c1-14(24)17-18(15-6-8-16(9-7-15)21(27)28-2)23(20(26)19(17)25)13-12-22-10-4-3-5-11-22/h6-9,18,25H,3-5,10-13H2,1-2H3 |
| InChIKey | ZVSKFOWEXBNZCN-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |