C22H28N2O4 — CID 75792703
3-acetyl-4-hydroxy-1-(2-piperidin-1-ylethyl)-2-(4-prop-2-enoxyphenyl)-2H-pyrrol-5-one (PubChem CID 75792703) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is 3-acetyl-4-hydroxy-1-(2-piperidin-1-ylethyl)-2-(4-prop-2-enoxyphenyl)-2H-pyrrol-5-one.
| Compound Name | 3-acetyl-4-hydroxy-1-(2-piperidin-1-ylethyl)-2-(4-prop-2-enoxyphenyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 75792703 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 3-acetyl-4-hydroxy-1-(2-piperidin-1-ylethyl)-2-(4-prop-2-enoxyphenyl)-2H-pyrrol-5-one |
| SMILES | C=CCOc1ccc(C2C(C(C)=O)=C(O)C(=O)N2CCN2CCCCC2)cc1 |
| InChI | InChI=1S/C22H28N2O4/c1-3-15-28-18-9-7-17(8-10-18)20-19(16(2)25)21(26)22(27)24(20)14-13-23-11-5-4-6-12-23/h3,7-10,20,26H,1,4-6,11-15H2,2H3 |
| InChIKey | RFGLTHLQJBIRQS-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|