C20H40OSi — CID 10925397
(Z,1S,2R)-1-cyclohexyl-2-methyl-4-trimethylsilyldec-3-en-1-ol (PubChem CID 10925397) has the molecular formula C20H40OSi and a molecular weight of 324.63 g/mol. Its IUPAC name is (Z,1S,2R)-1-cyclohexyl-2-methyl-4-trimethylsilyldec-3-en-1-ol.
| Compound Name | (Z,1S,2R)-1-cyclohexyl-2-methyl-4-trimethylsilyldec-3-en-1-ol |
|---|---|
| PubChem CID | 10925397 |
| Molecular Formula | C20H40OSi |
| Molecular Weight | 324.63 g/mol |
| Exact Mass | 324.28 |
| IUPAC Name | (Z,1S,2R)-1-cyclohexyl-2-methyl-4-trimethylsilyldec-3-en-1-ol |
| SMILES | CCCCCC/C(=C/[C@@H](C)[C@@H](O)C1CCCCC1)[Si](C)(C)C |
| InChI | InChI=1S/C20H40OSi/c1-6-7-8-12-15-19(22(3,4)5)16-17(2)20(21)18-13-10-9-11-14-18/h16-18,20-21H,6-15H2,1-5H3/b19-16-/t17-,20-/m1/s1 |
| InChIKey | CDHHLJTXNULVBV-CXRPIFAHSA-N |
| XLogP | 6.34 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.63 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|