About triethylsilyl 6-iodohexanoate
triethylsilyl 6-iodohexanoate (PubChem CID 10926360) has the molecular formula C12H25IO2Si
and a molecular weight of 356.32 g/mol. Its IUPAC name is triethylsilyl 6-iodohexanoate.
Molecular Properties
| Compound Name | triethylsilyl 6-iodohexanoate |
| PubChem CID | 10926360 |
| Molecular Formula | C12H25IO2Si |
| Molecular Weight | 356.32 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | triethylsilyl 6-iodohexanoate |
| SMILES | CC[Si](CC)(CC)OC(=O)CCCCCI |
| InChI | InChI=1S/C12H25IO2Si/c1-4-16(5-2,6-3)15-12(14)10-8-7-9-11-13/h4-11H2,1-3H3 |
| InChIKey | DBMMNIAGJVZUTA-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.32 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze triethylsilyl 6-iodohexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethylsilyl 6-iodohexanoate?
The IUPAC name of triethylsilyl 6-iodohexanoate (CID 10926360) is triethylsilyl 6-iodohexanoate.
What is the SMILES notation for triethylsilyl 6-iodohexanoate?
The canonical SMILES for triethylsilyl 6-iodohexanoate is CC[Si](CC)(CC)OC(=O)CCCCCI.
What is the InChIKey of triethylsilyl 6-iodohexanoate?
The InChIKey is DBMMNIAGJVZUTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25IO2Si/c1-4-16(5-2,6-3)15-12(14)10-8-7-9-11-13/h4-11H2,1-3H3.
What are the key properties of triethylsilyl 6-iodohexanoate?
triethylsilyl 6-iodohexanoate has a molecular weight of 356.32 g/mol, XLogP of 4.53, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for triethylsilyl 6-iodohexanoate is sourced from PubChem (CID 10926360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).